Return Styles: Pseud0ch, Terminal, Valhalla, NES, Geocities, Blue Moon.

Pages: 1-4041-8081-120121-

rogramming courses?

Name: Anonymous 2010-12-01 21:21

Dear /puddi/,

Why or why do so many people fail to learn programming?
Is it because they fail to see programming as calculation of data and instead see a black box that magically does things?

Or is it because they can't grasp the "strict" typing of a programming language?

What is it, /prog/, that makes programming so hard, even the introductory course seems so hard for people, even with languages like LISP or Python, and books like SICP?

Name: Anonymous 2010-12-01 22:19

Programming is easy. It can be understood by just thinking. You wont get any crazy paradoxes, like this incompletness paradox.

Mathematics, on the other hand, can't be understood at all. Try understand infinite or at least finite sets. How come, set's elements are "unordered"? Does such condition possible in real life? How many angels can dance on the head of a pin?

Name: Anonymous 2010-12-01 22:25

>>2
Try understand infinite
How come, set's elements
Does such condition possible

GRAMMAR MY ANUS

Name: Anonymous 2010-12-01 22:50

>>3
Yes, I should've used "try understanding" form and "Why set's elements". But whats wrong with "does condition possible"?

Name: Anonymous 2010-12-01 23:15

>>4

It's incorrect. You could have used

``Are such conditions possible''
``Do such conditions exist''

Or, if singular

``Is a condition like this possible''

But not ``Does such'' or ``Does condition''.

Name: Anonymous 2010-12-02 0:43

Just love how /prog/ completely ignores actual discussion and talks about stupid shit like mild grammar.

[quote]Mathematics, on the other hand, can't be understood at all. Try understand infinite or at least finite sets. How come, set's elements are "unordered"? Does such condition possible in real life? How many angels can dance on the head of a pin?[/quote]

Set elements are unordered because it let's us talk about more things with the same concept.  A set really just has a way of doing some basic things:

Add shit
Union sets
Intersect sets
Remove SOME element

Now think about a list.  You can:

Add shit to the front or back
Concatenate two lists
Intersect two lists (warning:  may require thinking!)
Remove shit from the front or back

Now think about a BST.  You can:

Add shit in a magic ordering
Union two trees (warning:  may require thinking!)
Intersect two trees (warning:  may require thinking!)
Remove shit

Sets are just a generalized model that can talk about several things at once.  Order just allows us to specify even more detail about the contents of a set.  Of course order requires you to first ask "What is order?" which may be answered by "Why do I care about order?"  Usually we just need a mapping from our set to the natural numbers or integers (whichever is more convenient).  Sometimes we need to have a larger set, like the reals.

Also, as for infinite stuff, it's more about talking about generalized models that help us think about things abstractly without getting worried about the specific details.  If the universe turns out to be quantized, then we don't need the reals.  Will we still use real analysis aka freshman calculus?  Hell yes.  It's convenient as hell.  Would you talk about a software project by talking about every specific asterisk, ampersand, and semicolon?  No!  You talk about class organization and really useful general design patterns.

Math is just a tool here.  And by thinking about weird stuff like the power set of the naturals we can then add specific details to model useful stuff.

Though honestly some of the stuff is pointless.  Like category theory.  A fucking sandwich fits into that stuff.

Name: Anonymous 2010-12-02 0:45

People are just going to ignore that though and make 50 replies about failing to quote properly instead.

Name: Anonymous 2010-12-02 1:45

>>6
You talk about class organization and really useful general design patterns.
I fucking puked all over my keyboard. Fuck!

Name: Anonymous 2010-12-02 6:53

>>5
LOL, I thought, "are" and "do" - both denote existence of a process, but "is" is more like "object" specific existence. Though I dont seed any fundamental difference between objects and actions, like Java-people do, they are all processes.

Name: Anonymous 2010-12-02 7:01

>>6
>Set elements are unordered because it let's us talk about more things with the same concept.
But all thing in real life have some relative order. Everything on my desktop ether on front of me, on the left or on the right. Everything in computer memory also has order. Not so in math.

Name: Anonymous 2010-12-02 7:03

>>6
>Now think about a list.  You can:
>Add shit to the front or back
>Concatenate two lists
You can sort list, then use binary search to
[quote]
Add shit
Union sets
Intersect sets
Remove SOME element
[/code]
in O(log2(N)) time

Name: Anonymous 2010-12-02 7:15

>>6
>Math is just a tool here.
Religion is also a tool. And has pretty much the same intentions - that is to scam people into submission to a state power. And mathemtical Infinity is pretty much like God, withs formulas being being rituals and prayers.

>And by thinking about weird stuff like the power set of the naturals we can then add specific details to model useful stuff.
What use has infinity? Or unordered set? Or the set of all "naturals"? IRL one always have finite number of naturals.

Name: Anonymous 2010-12-02 7:17

>>11
in O(log2(N)) time
Amortized O(log2N) time. Now go learn how to quote, ``faggot''.

Name: Anonymous 2010-12-02 7:25

>>10
>>11
>>12

Why are there so many people here from the imageboards?

You can tell it's them with their failed quoting, shitty posting, bad mathematics and overall unprogliness.

Name: Anonymous 2010-12-02 7:36

>>14
And you have nothing to say in defence of mathematics! Because math is a religion. Admit it.

Name: Anonymous 2010-12-02 8:21

The problem with math is: mathematician uses a mathematical metaphor to describe some concept. The metaphor isn't the thing he describes. But math allows one take the metaphor, and run with it, making arguments that are built entirely on metaphor, but which bear no relation to the real underlying concept. And they believe that whatever conclusions they draw from the metaphor must, therefore, apply to the original concept.

Name: Anonymous 2010-12-02 9:16

People who don't understand math and compare it to religion are hilarious.
Theistic religions typically require accepting something as truth without any verifiable facts and usually plays on emotional cues to manipulate the person.
Mathemathics is a very useful tool/framework which starts with some premises and derives a lot of things from them, thus "If A, B and C are accepted as true (define the system in some way, with some axioms) -> (possibly an) infinity of true statements follow from those base ideas". A lot of processes in real life can be modeled very well by math, while certain things like computer science are basically just a branch of math as everything is certain and user-defined. What math tells you is if you have one system, it will behave in a certain way, and it gives you the tools to investigate it.
Our reality may itself be mathematical (and computable) at its very foundations given its consistency so far, however since we are part of this reality, there are fundamental limitations about our ability to measure things (since we are ourselves made of these 'things' (whatever the basic element of reality is, for example, in a hypothethical theory it could be n-dimensional strings), thus we are such a pattern in the world which can only interact with other patterns). The best we can do is obtain an isomorphic model of our reality which does not fail at any tests we can throw at it, and that will be good enough, at least until we can find a failure point (if at all), and if we do, we just have to adjust the model or make a new one.

It's a bit sad when people don't understand the true nature of information, mathematics and reality itself.

Name: Anonymous 2010-12-02 9:22

>>14
>>12
>>13
>>14

failed quoting
( ≖‿≖)

Name: Anonymous 2010-12-02 9:23

>>15

Enjoy cleaning my pool in the near future.

Name: Anonymous 2010-12-02 10:21

Not only mathematics is false and invented by the rules but history is even worse, consult with http://www.bookmasters.com/marktplc/01098.htm?gclid=CKKot8TszaUCFVc03godR3Zllw for that refreshing feeling of truth.

Name: Anonymous 2010-12-02 10:28

fuck off sussman, why are you trolling us so much these days

Name: Anonymous 2010-12-02 10:33

>>17
>If A, B and C are accepted as true (define the system in some way, with some axioms) -> (possibly an) infinity of true statements follow from those base ideas".
And why should we believe in your crazy math axioms, that state that "for each N there exist N+1 > N". That isn't obvious at all, and in programming practice leads to integer overflow.

>Mathemathics is a very useful
"Useful" for whom? Can you show us usefulness of math?

>certain things like computer science are basically just a branch of math
And as we all know, computer science is a pseudoscience, that diverges far away from sensible reality. You won't find IRL these crazy turing machines or super-computations. Real computers are simple FSMs. No match needed.

>A lot of processes in real life can be modeled very well by math
In practice all "of processes in real life" are finite, so dont require math at all. You can model them with Lisp for that matter.

Name: Anonymous 2010-12-02 10:33

>>21
It is surprisingly easy to get the right answer with fallacious reasoning or without real understanding. Traditional mathematical notation contributes to this problem. Symbols have ambiguous meanings that depend on context, and often even change within a given context. -- Gerald Jay Sussman

Name: Anonymous 2010-12-02 10:37

Suppose we loosely define a religion as any discipline whose foundations rest on an element of faith, irrespective of any element of reason which may be present. [Atheism], for example, would be a religion under this definition. But mathematics would hold the unique position of being the only branch of theology possessing a rigorous demonstration of the fact that it should be so classified. -- H. Eves, Mathematical Circles, Boston: Prindle, Weber and Schmidt, 1969.

Name: Anonymous 2010-12-02 10:47

>>24
Okay, I smiled.

Name: Anonymous 2010-12-02 11:19

>>22
And why should we believe in your crazy math axioms
You shouldn't, moron. >>17 wrote: "If A, B and C are accepted as true", what letter of IF do you not understand, motherfucker?

and in programming practice leads to integer overflow.
If you were using a real programming language instead of a glorified FSM you wouldn't have any such problems. Until then you have no business calling yourself a programmer, you're a FSM operator. So shut the fuck up and go back to your FSM.

In practice all "of processes in real life" are finite, so dont require math at all. You can model them with Lisp for that matter.
You don't understand the difference between actual and potential infinities. Shut the fuck up and go back to your FSM, and also back to 0chan.

Name: Anonymous 2010-12-02 13:14

>>26
>If you were using a real programming language instead of a glorified FSM you wouldn't have any such problems.
You're still limited by the size of available memory. So there is no "halting problem": program ether stops or overflows memory.

Name: Anonymous 2010-12-02 13:22

Let do some hardcore math!

1. All computers, I've seen, had a finite amount of memory.
2. If we take computer with a finite amount of memory and add one bit of memory to it, we will still get a computer with finite amount of memory
3. Now, by induction, all computers have finite amount of memory.
4. Universe, as a computer, has a finite amount of memory, so Universe is finite.
5. If Universe is finite, then God is also finite.
6. But God is Infinity, so Infinity is finite.

Name: Anonymous 2010-12-02 13:46

>>28
I see what you did there.

Name: Anonymous 2010-12-02 14:07

>>28
Let do some hardcore math!
Stop reading right there.

Name: Anonymous 2010-12-02 16:33

>>27
You still do not understand the difference between actual and potential infinities, fgt lol.

Name: Anonymous 2010-12-02 16:36

>>31
Because there are the same, my poor nyasha.

Name: Anonymous 2010-12-02 17:34

math doesnt exist you sheep

Name: Anonymous 2010-12-02 18:51

sheep doesn't exist you sheep

Name: Anonymous 2010-12-02 18:58

exist dosent math you sheep

Name: Anonymous 2010-12-02 19:01

>>34,35
Please stop this at once!

Name: Anonymous 2010-12-02 21:34

>rogramming
>rogramming
>rogramming
>rogramming
>rogramming
>rogramming
>rogramming
>orrible
>orrible

Name: Anonymous 2010-12-02 23:04

/prog/

Where people go to just say YOU'RE WRONG YOU FUCKING IDIOT for one small thing and ignore any points or help rather than carry meaningful conversations about *le gasp* programming.

Name: Anonymous 2010-12-02 23:09

>>38
1. take screenshot
2. make demotivational
3. ????
4. PROFIT!!!

Name: Anonymous 2010-12-03 2:08

Let's do the Haskell!
Swing your penis around and slap some more!
Yes! Do the Haskell!
Slap your penis gently!
Jerk once!
jerk twice!
Slap your penis!
Praise the ribbon!
Do the Haskell!

Name: Anonymous 2010-12-03 7:23

>>22
Why should one define anything at all? Nobody is forcing you to "believe" into anything, you just take a system of your own definition, and if it's consistent, you'll arrive at a lot of properties of that system. The system doesn't have to be computable or of this world. While our world can only describe computable things, this doesn't mean that uncomputable systems don't let you reach some very interesting conclusions. You intentionally limit your worldview and thus will miss some pretty useful truths.
>>28 That's a lot of fallacies and ambiguous definitions right there.

Name: Anonymous 2010-12-03 10:18

>>41
>Why should one define anything at all? Nobody is forcing you to "believe" into anything, you just take a system of your own definition
That wont be mathematics then. LISP, for example, is also a system, but has nothing in common with mathematics.

and if it's consistent, you'll arrive at a lot of properties of that system.
Please, define "consistent" and "arrive".

>You intentionally limit your worldview and thus will miss some pretty useful truths.
What is "thruth"? Does such thing "exist"? What proves its "existence"? Can you prove that it really proves? No? Q.E.D.

>That's a lot of fallacies and ambiguous definitions right there.
Just as in math.

Name: Anonymous 2010-12-03 10:19

>>42
You just don't understand what mathemathics is and its scope.

Name: Anonymous 2010-12-03 10:21

>>43
In mathematics you don't understand things. You just get used to them. -- John von Neumann

Name: Gerald Jay Sussman !MhMRSATORI 2010-12-03 10:23

>>44

``You're a moron.'' -- Gerald Jay Sussman

Name: Anonymous 2010-12-03 10:26

>mathematics
It's what I call "mental masturbation", when you engage is some pointless intellectual exercise that has no possible meaning. -- Linus Torvalds

Name: Anonymous 2010-12-03 10:27

Epistula non erubescit. -- Cicero

Name: Anonymous 2010-12-03 10:36

Hax My Anus. -- /prog/

Name: Anonymous 2010-12-03 10:44

You probably know that arrogance, in computer science, is measured in nanodijkstras. -- Alan Kay

Name: Anonymous 2010-12-03 11:10

"Why or why do so many people fail to learn programming?"

Can we stop talking about math and philosophy and get back to the OP's original topic.

Name: Anonymous 2010-12-03 11:17

>>50
But many people insist that programming `equals` math, lol. For xample, every programmer is required to enroll calculus classes, where he will be brainwashed with all that infinity stuff, he will "learn" that the universe consists of so called "infinitesimals" and one can measure "distance" in "reals".

Name: Anonymous 2010-12-03 11:29

Lets assume that "infinity" exists, then:
- 1/oo is infinitesimal
- 1/oo * 1/oo = 1/oo
- 1/oo = 1
- oo = 1

Name: Anonymous 2010-12-03 11:33

Name: Anonymous 2010-12-03 11:44

Lets assume that "infinity" exists. Then one can conceive infinity series, where each even denominator is negative:
    x = /1 - /2 + /3 - /4 + /5 - /6 + ...
Note: here and below "/n" stands for a rational number "1/n"

Using commutativity of addtion, we rearrange elements in such a way, that after each positive number would go to two negative:
    x = /1 - /2 - /4  + /3 - /6 - /8 + /5 - /10 - /12 + ...

Now, using associativity of addtion, we group elements in following way:
    x = (/1 - /2) - /4  + (/3 - /6) - /8 + (/5 - /10) - /12 + ...

But (/1 - /2) = /2, (/3 - /6) = /6, etc.., so we have
    x = /2 - /4 + /6 - /8 + /10 - /12 + ...

Multiplying both sides by 2 gives us:
    2*x = /1 - /2 + /3 - /4 + /5 - /6 + ...

That is "x = 2*x" or "1 = 2"!

Name: Anonymous 2010-12-03 11:54

>>52
Золотце, ты?

Name: Anonymous 2010-12-03 11:57

>>55
NO U!

Name: Anonymous 2010-12-03 13:54

>>54
Almost got me.

Name: Anonymous 2010-12-03 14:30

>>54
Excellent!

Name: Anonymous 2010-12-03 17:24

>>54

Nice flawed logic using ellipses as if they're proper mathematics. Learn to limits. By rearranging in that manner, you're subtracting 'faster' than you're adding. I know ``faster'' isn't a proper mathematical concept in this respect, but this is essentially what you are doing. Subtracting twice as many terms as you are adding for each iteration of your ``loop''.

In more mathematical terms, you're saying that:

lim as n -> infinity of (the sum of i=1 to n of (1^(-i+1)/i))
= lim as n -> infinity of ( (the sum of i=1 to n of (1/(2i-1)) - (the sum of i=1 to (2n) of (1/(2i))) )

And bam you've got a phallusy fallacy.

Name: Anonymous 2010-12-03 17:28

lim as n -> infinity of (the sum of i=1 to n of (1^(-i+1)/i))
= lim as n -> infinity of ( (the sum of i=1 to n of (1/(2i-1))) - (the sum of i=1 to (2n) of (1/(2i))) )


Fixing that fucking parenthesis.

Name: Anonymous 2010-12-03 17:32

>>60
Mathematics == LISP

Name: Anonymous 2010-12-03 17:39

>>59
Learn to limits.
Learn to recognise your bitch tits and go back to /[[:alpha:]]/, ``please''.

Name: Anonymous 2010-12-03 17:45

>>59
Who cares about your speed to infinity? You'll never get there anyway.

Name: Anonymous 2010-12-03 17:55

>>63

HAR HAR HAR HAR HAR HAR ``faggot'' HAR HAR HAR HAR HAR HAR

Name: Anonymous 2010-12-03 18:13

>>60
how do i quote?

Name: Anonymous 2010-12-03 18:19

>>65
how do i quote

Like this:
>>>/b/
seriously go back to /b/

Name: Anonymous 2010-12-03 18:24

>>66
>>>
I think that you'll be go back there.

Name: Anonymous 2010-12-03 18:29

>>66
>>>You're a ``faggot''

Name: Anonymous 2010-12-03 18:39

>>68

PLEASE LEARN TO FUCKING ``sage'' WHEN SHITPOSTING.THANK YOU FOR YOUR ATTENTION ``faggot''

That was a lot of fucking enterprise BB code. This will most likely not work.

Name: Anonymous 2010-12-03 18:45

>>69

<blockquote>
    <p>
<a href="read/prog/1291256476/68">&gt;&gt;68</a><br/>
<br/>
<span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'"><sup><sup><sup><sup><sup><sup><span class="o"><span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'"><sub><sub><sub><sub><sub><sub><sub><sub><sub><sub><sub><sub><u><span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'"><sup><sup><sup><sup><sup><sup><sup><sup><sup><span class="o"><u><b><tt>PLEASE LEARN TO FUCKING ``sage'' WHEN SHITPOSTING.</tt></b></u></span></sup></sup></sup></sup></sup></sup><span class="o"><u><b><tt>THANK YOU FOR YOUR ATTENTION ``faggot''</tt></b></u></span></sup></sup></sup></span></u></sub></sub></sub></sub></sub></sub></sub></sub></sub></sub></sub></sub></span></span></sup></sup></sup></sup></sup></sup></span><br/>
<br/>
<sub><sub><sub><sub><sub><sub><tt><span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'">That was a lot of fucking enterprise BB code. This will most likely not work.</span></tt></sub></sub></sub></sub></sub></sub>
    </p>
</blockquote>

Name: Anonymous 2010-12-03 18:49

>>69
>Implying a bunch of subs and sups are enterprise work.


back to /b/,``faggot''

Name: Anonymous 2010-12-03 18:56

>>71
Implying this is how you quote:
>Implying a bunch of subs and sups are enterprise work.

Name: Anonymous 2010-12-03 18:58

>>71
fuck off fag

Name: Anonymous 2010-12-03 19:14

>>73
>>72
back to /b/,``faggot''

Name: Anonymous 2010-12-03 19:16

I know how to quote, but ">" is traditional.

Name: Anonymous 2010-12-03 19:20

Name: Anonymous 2010-12-03 19:22

>>76
Cool post as for me. It would be great to read a bit more concerning this topic. Thanks for giving that data.

Name: Anonymous 2010-12-03 19:26

[color=red]test[/color]

Name: Anonymous 2010-12-03 19:26

[color="red"]test[/color]

Name: Anonymous 2010-12-03 19:33

[color=ff0000]test[/color]

Name: Anonymous 2010-12-03 19:34

[color=0xff0000]test[/color]
[color=#ff0000]test[/color]
[color=FF0000]test[/color]
[color=0xFF0000]test[/color]
[color=#FF0000]test[/color]

Name: Anonymous 2010-12-03 19:35

[size=9]test[/size]

Name: Anonymous 2010-12-03 19:35

>>78
>>79
>>80
>>81
this is how you do color:
{color,green:testing}=>testing

Name: Anonymous 2010-12-03 19:37

>>83
correction:
{color,green.`testing}=>`testing

:=>.

Name: Anonymous 2010-12-03 19:40

{b,i,o,u.hello?}hello?

Name: Anonymous 2010-12-03 19:56

{b,o,u,sup,sup,sup,sup,m."Go back to /b/ "; spoiler."``faggot''s"}Go back to /b/ ``faggot''s

Name: Anonymous 2010-12-03 19:59

[a]test[/a]
test
[c]test[/c]
[d]test[/d]
[e]test[/e]
[f]test[/f]
[g]test[/g]
[h]test[/h]
test
[j]test[/j]
[k]test[/k]
[l]test[/l]
test
[n]test[/n]
test
[p]test[/p]
[q]test[/q]
[r]test[/r]
test
[t]test[/t]
test
[v]test[/v]
[w]test[/w]
[x]test[/x]
[y]test[/y]
[z]test[/z]
[0]test[/0]
[1]test[/1]
[2]test[/2]
[3]test[/3]
[4]test[/4]
[5]test[/5]
[6]test[/6]
[7]test[/7]
[8]test[/8]
[9]test[/9]

Name: Anonymous 2010-12-03 20:03

test
[ab]test[/ab]
[ac]test[/ac]
[ad]test[/ad]
[ae]test[/ae]
[af]test[/af]
[ag]test[/ag]
[ah]test[/ah]
[ai]test[/ai]
[aj]test[/aj]
[ak]test[/ak]
[al]test[/al]
[am]test[/am]
[an]test[/an]
[ao]test[/ao]
[ap]test[/ap]
[aq]test[/aq]
[ar]test[/ar]
[as]test[/as]
[at]test[/at]
[au]test[/au]
[av]test[/av]
[aw]test[/aw]
[ax]test[/ax]
[ay]test[/ay]
[az]test[/az]
[ba]test[/ba]
[bb]test[/bb]
[bc]test[/bc]
[bd]test[/bd]
[be]test[/be]
[bf]test[/bf]
[bg]test[/bg]
[bh]test[/bh]
[bi]test[/bi]
[bj]test[/bj]
[bk]test[/bk]
[bl]test[/bl]
[bm]test[/bm]
[bn]test[/bn]
[bo]test[/bo]
[bp]test[/bp]
[bq]test[/bq]

test[/br]
[bs]test[/bs]
[bt]test[/bt]
[bu]test[/bu]
[bv]test[/bv]
[bw]test[/bw]
[bx]test[/bx]
[by]test[/by]
[bz]test[/bz]
[ca]test[/ca]
[cb]test[/cb]
[cc]test[/cc]
[cd]test[/cd]
[ce]test[/ce]
[cf]test[/cf]
[cg]test[/cg]
[ch]test[/ch]
[ci]test[/ci]
[cj]test[/cj]
[ck]test[/ck]
[cl]test[/cl]
[cm]test[/cm]
[cn]test[/cn]
[co]test[/co]
[cp]test[/cp]
[cq]test[/cq]
[cr]test[/cr]
[cs]test[/cs]
[ct]test[/ct]
[cu]test[/cu]
[cv]test[/cv]
[cw]test[/cw]
[cx]test[/cx]
[cy]test[/cy]
[cz]test[/cz]
[da]test[/da]
[db]test[/db]
[dc]test[/dc]
[dd]test[/dd]
[de]test[/de]
[df]test[/df]
[dg]test[/dg]
[dh]test[/dh]
[di]test[/di]
[dj]test[/dj]
[dk]test[/dk]
[dl]test[/dl]
[dm]test[/dm]
[dn]test[/dn]
[do]test[/do]
[dp]test[/dp]
[dq]test[/dq]
[dr]test[/dr]
[ds]test[/ds]
[dt]test[/dt]
[du]test[/du]
[dv]test[/dv]
[dw]test[/dw]
[dx]test[/dx]
[dy]test[/dy]
[dz]test[/dz]
[ea]test[/ea]
[eb]test[/eb]
[ec]test[/ec]
[ed]test[/ed]
[ee]test[/ee]
[ef]test[/ef]
[eg]test[/eg]
[eh]test[/eh]
[ei]test[/ei]
[ej]test[/ej]
[ek]test[/ek]
[el]test[/el]
[em]test[/em]
[en]test[/en]
[eo]test[/eo]
[ep]test[/ep]
[eq]test[/eq]
[er]test[/er]
[es]test[/es]
[et]test[/et]
[eu]test[/eu]
[ev]test[/ev]
[ew]test[/ew]
[ex]test[/ex]
[ey]test[/ey]
[ez]test[/ez]
[fa]test[/fa]
[fb]test[/fb]
[fc]test[/fc]
[fd]test[/fd]
[fe]test[/fe]
[ff]test[/ff]
[fg]test[/fg]
[fh]test[/fh]
[fi]test[/fi]
[fj]test[/fj]
[fk]test[/fk]
[fl]test[/fl]
[fm]test[/fm]

Name: Anonymous 2010-12-03 20:03

[fn]test[/fn]
[fo]test[/fo]
[fp]test[/fp]
[fq]test[/fq]
[fr]test[/fr]
[fs]test[/fs]
[ft]test[/ft]
[fu]test[/fu]
[fv]test[/fv]
[fw]test[/fw]
[fx]test[/fx]
[fy]test[/fy]
[fz]test[/fz]
[ga]test[/ga]
[gb]test[/gb]
[gc]test[/gc]
[gd]test[/gd]
[ge]test[/ge]
[gf]test[/gf]
[gg]test[/gg]
[gh]test[/gh]
[gi]test[/gi]
[gj]test[/gj]
[gk]test[/gk]
[gl]test[/gl]
[gm]test[/gm]
[gn]test[/gn]
[go]test[/go]
[gp]test[/gp]
[gq]test[/gq]
[gr]test[/gr]
[gs]test[/gs]
[gt]test[/gt]
[gu]test[/gu]
[gv]test[/gv]
[gw]test[/gw]
[gx]test[/gx]
[gy]test[/gy]
[gz]test[/gz]
[ha]test[/ha]
[hb]test[/hb]
[hc]test[/hc]
[hd]test[/hd]
[he]test[/he]
[hf]test[/hf]
[hg]test[/hg]
[hh]test[/hh]
[hi]test[/hi]
[hj]test[/hj]
[hk]test[/hk]
[hl]test[/hl]
[hm]test[/hm]
[hn]test[/hn]
[ho]test[/ho]
[hp]test[/hp]
[hq]test[/hq]
[hr]test[/hr]
[hs]test[/hs]
[ht]test[/ht]
[hu]test[/hu]
[hv]test[/hv]
[hw]test[/hw]
[hx]test[/hx]
[hy]test[/hy]
[hz]test[/hz]
[ia]test[/ia]
[ib]test[/ib]
[ic]test[/ic]
[id]test[/id]
[ie]test[/ie]
[if]test[/if]
[ig]test[/ig]
[ih]test[/ih]
[ii]test[/ii]
[ij]test[/ij]
[ik]test[/ik]
[il]test[/il]
[im]test[/im]
[in]test[/in]
[io]test[/io]
[ip]test[/ip]
[iq]test[/iq]
[ir]test[/ir]
[is]test[/is]
[it]test[/it]
[iu]test[/iu]
[iv]test[/iv]
[iw]test[/iw]
[ix]test[/ix]
[iy]test[/iy]
[iz]test[/iz]
[ja]test[/ja]
[jb]test[/jb]
[jc]test[/jc]
[jd]test[/jd]
[je]test[/je]
[jf]test[/jf]
[jg]test[/jg]
[jh]test[/jh]
[ji]test[/ji]
[jj]test[/jj]
[jk]test[/jk]
[jl]test[/jl]
[jm]test[/jm]
[jn]test[/jn]
[jo]test[/jo]
[jp]test[/jp]
[jq]test[/jq]
[jr]test[/jr]
[js]test[/js]
[jt]test[/jt]
[ju]test[/ju]
[jv]test[/jv]
[jw]test[/jw]
[jx]test[/jx]
[jy]test[/jy]
[jz]test[/jz]
[ka]test[/ka]
[kb]test[/kb]
[kc]test[/kc]
[kd]test[/kd]
[ke]test[/ke]
[kf]test[/kf]
[kg]test[/kg]
[kh]test[/kh]
[ki]test[/ki]
[kj]test[/kj]
[kk]test[/kk]
[kl]test[/kl]
[km]test[/km]
[kn]test[/kn]
[ko]test[/ko]
[kp]test[/kp]
[kq]test[/kq]
[kr]test[/kr]
[ks]test[/ks]
[kt]test[/kt]
[ku]test[/ku]
[kv]test[/kv]
[kw]test[/kw]
[kx]test[/kx]
[ky]test[/ky]
[kz]test[/kz]
[la]test[/la]
[lb]test[/lb]
[lc]test[/lc]
[ld]test[/ld]
[le]test[/le]
[lf]test[/lf]
[lg]test[/lg]
[lh]test[/lh]
[li]test[/li]
[lj]test[/lj]
[lk]test[/lk]
[ll]test[/ll]
[lm]test[/lm]
[ln]test[/ln]
[lo]test[/lo]
[lp]test[/lp]
[lq]test[/lq]
[lr]test[/lr]
[ls]test[/ls]
[lt]test[/lt]
[lu]test[/lu]
[lv]test[/lv]
[lw]test[/lw]
[lx]test[/lx]
[ly]test[/ly]
[lz]test[/lz]
[ma]test[/ma]
[mb]test[/mb]
[mc]test[/mc]
[md]test[/md]
[me]test[/me]
[mf]test[/mf]
[mg]test[/mg]
[mh]test[/mh]
[mi]test[/mi]
[mj]test[/mj]
[mk]test[/mk]
[ml]test[/ml]
[mm]test[/mm]
[mn]test[/mn]
[mo]test[/mo]
[mp]test[/mp]
[mq]test[/mq]
[mr]test[/mr]
[ms]test[/ms]
[mt]test[/mt]
[mu]test[/mu]
[mv]test[/mv]
[mw]test[/mw]
[mx]test[/mx]
[my]test[/my]
[mz]test[/mz]
[na]test[/na]
[nb]test[/nb]
[nc]test[/nc]
[nd]test[/nd]
[ne]test[/ne]
[nf]test[/nf]
[ng]test[/ng]
[nh]test[/nh]
[ni]test[/ni]
[nj]test[/nj]
[nk]test[/nk]
[nl]test[/nl]
[nm]test[/nm]
[nn]test[/nn]
[no]test[/no]
[np]test[/np]
[nq]test[/nq]
[nr]test[/nr]
[ns]test[/ns]
[nt]test[/nt]
[nu]test[/nu]
[nv]test[/nv]
[nw]test[/nw]
[nx]test[/nx]
[ny]test[/ny]
[nz]test[/nz]
[oa]test[/oa]
[ob]test[/ob]
[oc]test[/oc]
[od]test[/od]
[oe]test[/oe]
[of]test[/of]
[og]test[/og]
[oh]test[/oh]
[oi]test[/oi]
[oj]test[/oj]
[ok]test[/ok]
[ol]test[/ol]
[om]test[/om]
[on]test[/on]
[oo]test[/oo]
[op]test[/op]
[oq]test[/oq]
[or]test[/or]
[os]test[/os]
[ot]test[/ot]
[ou]test[/ou]
[ov]test[/ov]
[ow]test[/ow]
[ox]test[/ox]
[oy]test[/oy]
[oz]test[/oz]
[pa]test[/pa]
[pb]test[/pb]
[pc]test[/pc]
[pd]test[/pd]
[pe]test[/pe]
[pf]test[/pf]
[pg]test[/pg]
[ph]test[/ph]
[pi]test[/pi]
[pj]test[/pj]
[pk]test[/pk]
[pl]test[/pl]
[pm]test[/pm]
[pn]test[/pn]
[po]test[/po]
[pp]test[/pp]
[pq]test[/pq]
[pr]test[/pr]
[ps]test[/ps]
[pt]test[/pt]
[pu]test[/pu]
[pv]test[/pv]
[pw]test[/pw]
[px]test[/px]
[py]test[/py]
[pz]test[/pz]
[qa]test[/qa]
[qb]test[/qb]
[qc]test[/qc]
[qd]test[/qd]
[qe]test[/qe]
[qf]test[/qf]
[qg]test[/qg]
[qh]test[/qh]
[qi]test[/qi]
[qj]test[/qj]
[qk]test[/qk]
[ql]test[/ql]
[qm]test[/qm]
[qn]test[/qn]
[qo]test[/qo]
[qp]test[/qp]
[qq]test[/qq]
[qr]test[/qr]
[qs]test[/qs]
[qt]test[/qt]
[qu]test[/qu]
[qv]test[/qv]
[qw]test[/qw]
[qx]test[/qx]
[qy]test[/qy]
[qz]test[/qz]
[ra]test[/ra]
[rb]test[/rb]
[rc]test[/rc]
[rd]test[/rd]
[re]test[/re]
[rf]test[/rf]
[rg]test[/rg]
[rh]test[/rh]
[ri]test[/ri]
[rj]test[/rj]
[rk]test[/rk]
[rl]test[/rl]
[rm]test[/rm]
[rn]test[/rn]
[ro]test[/ro]
[rp]test[/rp]
[rq]test[/rq]
[rr]test[/rr]
[rs]test[/rs]
[rt]test[/rt]
[ru]test[/ru]
[rv]test[/rv]
[rw]test[/rw]
[rx]test[/rx]
[ry]test[/ry]
[rz]test[/rz]
[sa]test[/sa]
[sb]test[/sb]
[sc]test[/sc]
[sd]test[/sd]
[se]test[/se]
[sf]test[/sf]
[sg]test[/sg]
[sh]test[/sh]
[si]test[/si]
[sj]test[/sj]
[sk]test[/sk]
[sl]test[/sl]
[sm]test[/sm]
[sn]test[/sn]
[so]test[/so]
[sp]test[/sp]
[sq]test[/sq]
[sr]test[/sr]
[ss]test[/ss]
[st]test[/st]
[su]test[/su]
[sv]test[/sv]
[sw]test[/sw]
[sx]test[/sx]
[sy]test[/sy]
[sz]test[/sz]
[ta]test[/ta]
[tb]test[/tb]
[tc]test[/tc]
[td]test[/td]
[te]test[/te]
[tf]test[/tf]
[tg]test[/tg]
[th]test[/th]
[ti]test[/ti]
[tj]test[/tj]
[tk]test[/tk]
[tl]test[/tl]
[tm]test[/tm]
[tn]test[/tn]
[to]test[/to]
[tp]test[/tp]
[tq]test[/tq]
[tr]test[/tr]
[ts]test[/ts]
[tt]test[/tt]
[tu]test[/tu]
[tv]test[/tv]
[tw]test[/tw]
[tx]test[/tx]
[ty]test[/ty]
[tz]test[/tz]
[ua]test[/ua]
[ub]test[/ub]
[uc]test[/uc]
[ud]test[/ud]
[ue]test[/ue]
[uf]test[/uf]
[ug]test[/ug]
[uh]test[/uh]
[ui]test[/ui]
[uj]test[/uj]
[uk]test[/uk]
[ul]test[/ul]
[um]test[/um]
[un]test[/un]
[uo]test[/uo]
[up]test[/up]
[uq]test[/uq]
[ur]test[/ur]
[us]test[/us]
[ut]test[/ut]
[uu]test[/uu]
[uv]test[/uv]
[uw]test[/uw]
[ux]test[/ux]
[uy]test[/uy]
[uz]test[/uz]
[va]test[/va]
[vb]test[/vb]
[vc]test[/vc]
[vd]test[/vd]
[ve]test[/ve]
[vf]test[/vf]
[vg]test[/vg]
[vh]test[/vh]
[vi]test[/vi]
[vj]test[/vj]
[vk]test[/vk]
[vl]test[/vl]
[vm]test[/vm]
[vn]test[/vn]
[vo]test[/vo]
[vp]test[/vp]
[vq]test[/vq]
[vr]test[/vr]
[vs]test[/vs]
[vt]test[/vt]
[vu]test[/vu]
[vv]test[/vv]
[vw]test[/vw]
[vx]test[/vx]
[vy]test[/vy]
[vz]test[/vz]
[wa]test[/wa]
[wb]test[/wb]
[wc]test[/wc]
[wd]test[/wd]
[we]test[/we]
[wf]test[/wf]
[wg]test[/wg]
[wh]test[/wh]
[wi]test[/wi]
[wj]test[/wj]
[wk]test[/wk]
[wl]test[/wl]
[wm]test[/wm]
[wn]test[/wn]
[wo]test[/wo]
[wp]test[/wp]
[wq]test[/wq]
[wr]test[/wr]
[ws]test[/ws]
[wt]test[/wt]
[wu]test[/wu]
[wv]test[/wv]
[ww]test[/ww]
[wx]test[/wx]
[wy]test[/wy]
[wz]test[/wz]
[xa]test[/xa]
[xb]test[/xb]
[xc]test[/xc]
[xd]test[/xd]
[xe]test[/xe]
[xf]test[/xf]
[xg]test[/xg]
[xh]test[/xh]
[xi]test[/xi]
[xj]test[/xj]
[xk]test[/xk]
[xl]test[/xl]
[xm]test[/xm]
[xn]test[/xn]
[xo]test[/xo]
[xp]test[/xp]
[xq]test[/xq]
[xr]test[/xr]
[xs]test[/xs]
[xt]test[/xt]
[xu]test[/xu]
[xv]test[/xv]
[xw]test[/xw]
[xx]test[/xx]
[xy]test[/xy]
[xz]test[/xz]
[ya]test[/ya]
[yb]test[/yb]
[yc]test[/yc]
[yd]test[/yd]
[ye]test[/ye]
[yf]test[/yf]
[yg]test[/yg]
[yh]test[/yh]
[yi]test[/yi]
[yj]test[/yj]
[yk]test[/yk]
[yl]test[/yl]
[ym]test[/ym]
[yn]test[/yn]
[yo]test[/yo]
[yp]test[/yp]
[yq]test[/yq]
[yr]test[/yr]
[ys]test[/ys]
[yt]test[/yt]
[yu]test[/yu]
[yv]test[/yv]
[yw]test[/yw]
[yx]test[/yx]
[yy]test[/yy]
[yz]test[/yz]
[za]test[/za]
[zb]test[/zb]
[zc]test[/zc]
[zd]test[/zd]
[ze]test[/ze]
[zf]test[/zf]
[zg]test[/zg]
[zh]test[/zh]
[zi]test[/zi]
[zj]test[/zj]
[zk]test[/zk]
[zl]test[/zl]
[zm]test[/zm]
[zn]test[/zn]
[zo]test[/zo]
[zp]test[/zp]
[zq]test[/zq]
[zr]test[/zr]
[zs]test[/zs]
[zt]test[/zt]
[zu]test[/zu]
[zv]test[/zv]
[zw]test[/zw]
[zx]test[/zx]
[zy]test[/zy]
[zz]test[/zz]

Name: Anonymous 2010-12-03 20:07

[<]test[/<]
[>]test[/>]
["]test[/"]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[    ]test[/    ]
[
]test[/
]
[ ]test[/ ]
[ ]test[/ ]
[
]test[/
]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[]test[/]
[ ]test[/ ]
[!]test[/!]
["]test[/"]
test
[$]test[/$]
[%]test[/%]
[&]test[/&]
[']test[/']
[(]test[/(]
[)]test[/)]
[*]test[/*]
[+]test[/+]
[,]test[/,]
[-]test[/-]
[.]test[/.]
[/]test[//]
[0]test[/0]
[1]test[/1]
[2]test[/2]
[3]test[/3]
[4]test[/4]
[5]test[/5]
[6]test[/6]
[7]test[/7]
[8]test[/8]
[9]test[/9]
[:]test[/:]
[;]test[/;]
[<]test[/<]
[=]test[/=]
[>]test[/>]
[?]test[/?]
[@]test[/@]
[A]test[/A]
test
[C]test[/C]
[D]test[/D]
[E]test[/E]
[F]test[/F]
[G]test[/G]
[H]test[/H]
test
[J]test[/J]
[K]test[/K]
[L]test[/L]
test
[N]test[/N]
test
[P]test[/P]
[Q]test[/Q]
[R]test[/R]
test
[T]test[/T]
test
[V]test[/V]
[W]test[/W]
[X]test[/X]
[Y]test[/Y]
[Z]test[/Z]
[[]test[/[]
[\]test[/\]
[]]test[/]]
[^]test[/^]
[_]test[/_]
[`]test[/`]
[a]test[/a]
test
[c]test[/c]
[d]test[/d]
[e]test[/e]
[f]test[/f]
[g]test[/g]
[h]test[/h]
test
[j]test[/j]
[k]test[/k]
[l]test[/l]
test
[n]test[/n]
test
[p]test[/p]
[q]test[/q]
[r]test[/r]
test
[t]test[/t]
test
[v]test[/v]
[w]test[/w]
[x]test[/x]
[y]test[/y]
[z]test[/z]
[{]test[/{]
[|]test[/|]
[}]test[/}]
[~]test[/~]
[]test[/]
[€]test[/€]
[]test[/]
[‚]test[/‚]
[ƒ]test[/ƒ]
[„]test[/„]
[…]test[/…]
[†]test[/†]
[‡]test[/‡]
[ˆ]test[/ˆ]
[‰]test[/‰]
[Š]test[/Š]
[‹]test[/‹]
[Œ]test[/Œ]
[]test[/]
[Ž]test[/Ž]
[]test[/]
[]test[/]
[‘]test[/‘]
[’]test[/’]
[“]test[/“]
[”]test[/”]
[•]test[/•]
[–]test[/–]
[—]test[/—]
[˜]test[/˜]
[™]test[/™]
[š]test[/š]
[›]test[/›]
[œ]test[/œ]
[]test[/]
[ž]test[/ž]
[Ÿ]test[/Ÿ]
[ ]test[/ ]
[¡]test[/¡]
[¢]test[/¢]
[£]test[/£]
[¤]test[/¤]
[¥]test[/¥]
[¦]test[/¦]
[§]test[/§]
[¨]test[/¨]
[©]test[/©]
[ª]test[/ª]
[«]test[/«]
[¬]test[/¬]
[­]test[/­]
[®]test[/®]
[¯]test[/¯]
[°]test[/°]
[±]test[/±]
[²]test[/²]
[³]test[/³]
[´]test[/´]
[µ]test[/µ]
[¶]test[/¶]
[·]test[/·]
[¸]test[/¸]
[¹]test[/¹]
[º]test[/º]
[»]test[/»]
[¼]test[/¼]
[½]test[/½]
[¾]test[/¾]
[¿]test[/¿]
[À]test[/À]
[Á]test[/Á]
[Â]test[/Â]
[Ã]test[/Ã]
[Ä]test[/Ä]
[Å]test[/Å]
[Æ]test[/Æ]
[Ç]test[/Ç]
[È]test[/È]
[É]test[/É]
[Ê]test[/Ê]
[Ë]test[/Ë]
[Ì]test[/Ì]
[Í]test[/Í]
[Î]test[/Î]
[Ï]test[/Ï]
[Ð]test[/Ð]
[Ñ]test[/Ñ]
[Ò]test[/Ò]
[Ó]test[/Ó]
[Ô]test[/Ô]
[Õ]test[/Õ]
[Ö]test[/Ö]
[×]test[/×]
[Ø]test[/Ø]
[Ù]test[/Ù]
[Ú]test[/Ú]
[Û]test[/Û]
[Ü]test[/Ü]
[Ý]test[/Ý]
[Þ]test[/Þ]
[ß]test[/ß]
[à]test[/à]
[á]test[/á]
[â]test[/â]
[ã]test[/ã]
[ä]test[/ä]
[å]test[/å]
[æ]test[/æ]
[ç]test[/ç]
[è]test[/è]
[é]test[/é]
[ê]test[/ê]
[ë]test[/ë]
[ì]test[/ì]
[í]test[/í]
[î]test[/î]
[ï]test[/ï]
[ð]test[/ð]
[ñ]test[/ñ]
[ò]test[/ò]
[ó]test[/ó]
[ô]test[/ô]
[õ]test[/õ]
[ö]test[/ö]
[÷]test[/÷]
[ø]test[/ø]
[ù]test[/ù]
[ú]test[/ú]
[û]test[/û]
[ü]test[/ü]
[ý]test[/ý]
[þ]test[/þ]
[ÿ]test[/ÿ]

Name: Anonymous 2010-12-03 20:34

cant delete my own posts :(

Name: Anonymous 2010-12-03 22:46

No one in /puddi/ can program.

LISP sucks, SICP sucks, C cusks, you all sPUDDIuck.

Name: Anonymous 2010-12-03 23:03

>>74
eat shit and die

Name: VIPPER 2010-12-04 4:01

JEWS

Name: Anonymous 2010-12-04 4:32

Name: Anonymous 2010-12-04 4:55

>>95
ENJOY YOUR FAIL AND AIDS, /PROG/

Name: Anonymous 2010-12-04 4:58

>>96
see >>95

Name: Anonymous 2010-12-04 5:01

>>>>97
see >>96

Name: Anonymous 2010-12-04 5:42

>>98
see >>97

Name: Anonymous 2010-12-04 5:44

>>99
check my dubs

Name: Anonymous 2010-12-04 5:44

>>99
see >>98

Name: Anonymous 2010-12-04 5:45

SARAH PALINDROMIC 101 GET!

Name: Anonymous 2010-12-04 5:45

you gay, >>100

Name: Anonymous 2010-12-04 5:51

>>101
see >>99

Name: Anonymous 2010-12-04 6:10

>>104
see pples

Name: Anonymous 2010-12-04 6:11

>>105
skeem sharp

Name: Anonymous 2011-02-03 0:58

Name: ‮Anonymous 2011-04-05 15:30

<span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'"><b><span class="o"><u><i>Faggot</i></u></span></b></span>

this

Name: Anonymous 2011-04-05 15:32

    ▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄
    █     ___                        █
    █    //  7                       █
    █   (_,_/\       WORSHIP THIS    █
    █    \    \   YOUR THROBBING GOD █
    █     \    \                     █
    █     _\    \__                  █
    █    (   \     )                 █
    █     \___\___/                  █
    █                                █
    ▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀

Name: ‮Anonymous 2011-04-05 15:35


<span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'"><b><span class="o"><u><i>EXPERT UNICODE USERS</i></u></span></b></span>

Name: Anonymous 2011-04-05 15:47

[quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote][quote]quoting quotes.[/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote][/quote]

Name: Anonymous 2011-04-05 15:48

Spoiling spoilers.

Name: Anonymous 2011-04-05 15:49

[b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b][b]bolding bolds[/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b][/b]

Name: Anonymous 2011-04-05 15:50

>>112
How about
hax my anus

Name: Anonymous 2011-04-05 15:51

>>114
[quote]<span class="spoiler" onmouseover="this.style.color='#FFF';" onmouseout="this.style.color=this.style.backgroundColor='#000'"><sup><sup><sup><sup><sup><sup><sup><sup><sup><sup><sup><sup><sup><sup><sup>hax my anus</sup></sup></sup></sup></sup></sup></sup></sup></sup></sup></sup></sup></sup></sup></sup></span>
[/quote]

Lawl

Name: Anonymous 2011-04-05 15:52

>>115
U srs?

Name: Anonymous 2011-04-05 15:54

>>>    ▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄▄
>>>    █     ___                        █
>>>    █    //  7                       █
>>>    █   (_,_/\       WORSHIP THIS    █
>>>    █    \    \   YOUR THROBBING GOD █
>>>    █     \    \                     █
>>>    █     _\    \__                  █
>>>    █    (   \     )                 █
>>>    █     \___\___/                  █
>>>    █                                █
>>>    ▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀▀

Name: PUDDI 2011-04-05 16:07

PUDDI

Name: Anonymous 2011-04-05 16:08

>>116
R U?

Name: Anonymous 2011-04-05 16:47

Learning to programming has more to do with motivation, interest, and drive then anything else.  Most people find it fucking boring, so they lack all of those things required to get it down. 

Me personally, I found it difficult to learn to program on my own (I mean, learn to program WELL on my own... learning the basics and writing simple shit is a cakewalk), but I am one of the most undisciplined and motivated people in the world.  So when I actually started taking courses at college, where there was a structure set in place for me to follow and actual deadlines, then it came to me quite easily.

tl;dr - Everyone is different, but most of the people I know who fail at programming are smart enough to do it, they just don't have the motivation (or the autism) needed to become a good programmer.

Name: Anonymous 2011-04-05 16:50

Most people just don't have the motivation (or the autism) needed to become a good programmer.

Oh my dog, I want a t-shirt with that phrase

Name: Anonymous 2011-04-05 16:51

>>120
(or the autism)
Please, stop it.

Name: Anonymous 2011-04-05 16:55

>>122

I can't help it, I was born this way.

Name: Anonymous 2011-04-05 19:04

I think that more often than people outright fail to understand programming, they just don't know how to overcome the obstacles they encounter.

I remember my first programming class in highschool, I went through half of it trying to outright write an entire program before compiling it, without completely understanding what I was doing. Then when it didn't work, I would ask people until someone told me what was wrong. This is the model of problem solving people are used to in an academic environment. In most academic fields, the work you do doesn't have to be perfect, just be decent and look good. You hand it in, get a grade, and move on.

Programming doesn't conform to this model. People used to the model will do their best to write a program using their normal techniques, and when they fail, they will get frustrated and give up because they don't know what else to do.

Basically, the problem is a combination of the wrong approach, an unwillingness to accept the unforgiving critique of a computer, and a lack of a burning desire to solve problems and/or masochistic rage.

Name: Anonymous 2011-04-05 19:36

Programming should be stimulating on an intellectual level as well as creative and expressive in nature. Most newcomers fail to grasp the primary theory behind such an expression, or don't see any reason to partake in this at all. The purpose of programming IMO extends beyond sole semantics to a level of creative joy in not only solving a problem, but doing it well.

It is my understanding that most newcomers feel they will be able to program sufficiently in a given language simply by reading a book or two about it, when really the only solid way to learn is to do. I'd like to make a personal note here that I learned my first language through trial and error; I read maybe two or three introductory pages on syntax from a book then dove straight into forming whatever ideas crossed my mind into compilable code, referencing the book and various manual pages for unknown API.

I don't enjoy discussing why someone can't do something, rather how someone will be able to do this. My hypothesis is that the subject needs to first have the aptitude or desire to learn such a thing, and secondly must have some guidance on where to start with a source to reference as it becomes necessary for the subject to utilizes other aspects of the language/interface. You could also forcefully create a scenario where learning such a thing is required; such as injecting the subject with some poisonous substance, preferably NOT a neuro-toxin, and telling them they have 48 hours to become sufficient in the language lest the proctor fails to supply the antidote for such a poison and the subject dies.

Another hypothesis I have is one of getting the subject generally interested in this field. As it has been noted, there has been an overall decline in the willingness to pursue the field of computer science, perhaps because most people are generally intimidated by such systems and thus feel as though they will fail whilst attempting to understand the composition of such a thing. Creating an interest in computer science requires a connection to be made, in the subject's mind, between the utilization of computer systems and their own personal interests. This can be easily accomplished on an individual basis, but a sufficient starting point would be to revoke the preconceived notion of extreme complexity of such systems (perhaps through demonstration) on a moderately large group of subjects.

Well, there's my two cents.
Please continue the discussion, anus haxers

Name: Anonymous 2011-04-05 20:26

>>124
>>125
That was Steve Yegge quality!

Name: Anonymous 2011-04-05 21:26

>>125
tl;dr people find programming too complex to be worth the effort and resulting payout

Name: Anonymous 2011-04-06 19:01

The first two genuine replies out of a couple hundred posts, and the thread sages along to the back of the bus.

Name: Anonymous 2011-04-07 3:49

>>128
It's just not terribly interesting (not that other threads are).

Don't change these.
Name: Email:
Entire Thread Thread List